![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Molecules in Strong Magnetic Fields.pdf | 2024-02-14 15:17 | 93M | |
| High-Accuracy Quantum Chemistry.pdf | 2024-02-14 15:17 | 1.0M | |
| Molecular Dynamics after Photoexcitation, including non-Born-Oppenheimer Effects.pdf | 2024-02-14 15:16 | 7.9M | |
| HF and SCF.pdf | 2024-02-14 10:21 | 1.2M | |
| Matrix Calculation in Quantum Chemistry.pdf | 2024-02-14 10:20 | 1.7M | |
| Standard Model_MCSCF.pdf | 2024-02-12 23:35 | 9.0M | |
| Standard Model_CI.pdf | 2024-02-12 16:46 | 3.9M | |
| Standard Model_CC.pdf | 2024-02-12 16:46 | 6.1M | |
| Exact and Approximation Wave functions.pdf | 2024-02-12 16:46 | 819K | |